C30H45ClN3O5S+ — CID 87450472
[2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-[2-[4-(methylaminomethyl)phenyl]ethyl]azanium;methanesulfonic acid;hydrochloride (PubChem CID 87450472) has the molecular formula C30H45ClN3O5S+ and a molecular weight of 595.23 g/mol. Its IUPAC name is [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-[2-[4-(methylaminomethyl)phenyl]ethyl]azanium;methanesulfonic acid;hydrochloride.
| Compound Name | [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-[2-[4-(methylaminomethyl)phenyl]ethyl]azanium;methanesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 87450472 |
| Molecular Formula | C30H45ClN3O5S+ |
| Molecular Weight | 595.23 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-[2-[4-(methylaminomethyl)phenyl]ethyl]azanium;methanesulfonic acid;hydrochloride |
| SMILES | CNCc1ccc(CC[N+](C)(C)Cc2cnc(C(O)(c3ccccc3)C3CCCCC3)o2)cc1.CS(=O)(=O)O.Cl |
| InChI | InChI=1S/C29H40N3O2.CH4O3S.ClH/c1-30-20-24-16-14-23(15-17-24)18-19-32(2,3)22-27-21-31-28(34-27)29(33,25-10-6-4-7-11-25)26-12-8-5-9-13-26;1-5(2,3)4;/h4,6-7,10-11,14-17,21,26,30,33H,5,8-9,12-13,18-20,22H2,1-3H3;1H3,(H,2,3,4);1H/q+1;; |
| InChIKey | MRHPVJIGTQFRTB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|