C30H42ClN3O3 — CID 25002783
[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[3-[4-(methylaminomethyl)phenoxy]propyl]azanium chloride (PubChem CID 25002783) has the molecular formula C30H42ClN3O3 and a molecular weight of 528.14 g/mol. Its IUPAC name is [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[3-[4-(methylaminomethyl)phenoxy]propyl]azanium chloride.
| Compound Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[3-[4-(methylaminomethyl)phenoxy]propyl]azanium chloride |
|---|---|
| PubChem CID | 25002783 |
| Molecular Formula | C30H42ClN3O3 |
| Molecular Weight | 528.14 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[3-[4-(methylaminomethyl)phenoxy]propyl]azanium chloride |
| SMILES | CNCc1ccc(OCCC[N+](C)(C)Cc2cnc([C@](O)(c3ccccc3)C3CCCCC3)o2)cc1.[Cl-] |
| InChI | InChI=1S/C30H42N3O3.ClH/c1-31-21-24-15-17-27(18-16-24)35-20-10-19-33(2,3)23-28-22-32-29(36-28)30(34,25-11-6-4-7-12-25)26-13-8-5-9-14-26;/h4,6-7,11-12,15-18,22,26,31,34H,5,8-10,13-14,19-21,23H2,1-3H3;1H/q+1;/p-1/t30-;/m0./s1 |
| InChIKey | UPSQFASLRPUSBM-CZCBIWLKSA-M |
| XLogP | 2.26 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|