C66H80N4O12S2 — CID 24875343
bis([2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium);naphthalene-1,5-disulfonate (PubChem CID 24875343) has the molecular formula C66H80N4O12S2 and a molecular weight of 1185.52 g/mol. Its IUPAC name is bis([2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium);naphthalene-1,5-disulfonate.
| Compound Name | bis([2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium);naphthalene-1,5-disulfonate |
|---|---|
| PubChem CID | 24875343 |
| Molecular Formula | C66H80N4O12S2 |
| Molecular Weight | 1185.52 g/mol |
| Exact Mass | 1184.52 |
| IUPAC Name | bis([2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium);naphthalene-1,5-disulfonate |
| SMILES | C[N+](C)(CCCOc1ccccc1)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1.C[N+](C)(CCCOc1ccccc1)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1.O=S(=O)([O-])c1cccc2c(S(=O)(=O)[O-])cccc12 |
| InChI | InChI=1S/2C28H37N2O3.C10H8O6S2/c2*1-30(2,19-12-20-32-25-17-10-5-11-18-25)22-26-21-29-27(33-26)28(31,23-13-6-3-7-14-23)24-15-8-4-9-16-24;11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h2*3,5-7,10-11,13-14,17-18,21,24,31H,4,8-9,12,15-16,19-20,22H2,1-2H3;1-6H,(H,11,12,13)(H,14,15,16)/q2*+1;/p-2/t2*28-;/m00./s1 |
| InChIKey | SKWAUPZGNUHCRH-VRRQLQECSA-L |
| XLogP | 11.72 |
| TPSA | 225.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1185.52 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|