C29H38N2O4 — CID 87449391
[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenylpropyl)azanium formate (PubChem CID 87449391) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenylpropyl)azanium formate.
| Compound Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenylpropyl)azanium formate |
|---|---|
| PubChem CID | 87449391 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenylpropyl)azanium formate |
| SMILES | C[N+](C)(CCCc1ccccc1)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1.O=C[O-] |
| InChI | InChI=1S/C28H37N2O2.CH2O2/c1-30(2,20-12-15-23-13-6-3-7-14-23)22-26-21-29-27(32-26)28(31,24-16-8-4-9-17-24)25-18-10-5-11-19-25;2-1-3/h3-4,6-9,13-14,16-17,21,25,31H,5,10-12,15,18-20,22H2,1-2H3;1H,(H,2,3)/q+1;/p-1/t28-;/m0./s1 |
| InChIKey | SRFLXLVICZACTO-JCOPYZAKSA-M |
| XLogP | 4.07 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|