C29H37N2O4+ — CID 87721579
[2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-[2-oxo-2-(2-phenylethoxy)ethyl]azanium (PubChem CID 87721579) has the molecular formula C29H37N2O4+ and a molecular weight of 477.63 g/mol. Its IUPAC name is [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-[2-oxo-2-(2-phenylethoxy)ethyl]azanium.
| Compound Name | [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-[2-oxo-2-(2-phenylethoxy)ethyl]azanium |
|---|---|
| PubChem CID | 87721579 |
| Molecular Formula | C29H37N2O4+ |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-[2-oxo-2-(2-phenylethoxy)ethyl]azanium |
| SMILES | C[N+](C)(CC(=O)OCCc1ccccc1)Cc1cnc(C(O)(c2ccccc2)C2CCCCC2)o1 |
| InChI | InChI=1S/C29H37N2O4/c1-31(2,22-27(32)34-19-18-23-12-6-3-7-13-23)21-26-20-30-28(35-26)29(33,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-4,6-9,12-15,20,25,33H,5,10-11,16-19,21-22H2,1-2H3/q+1 |
| InChIKey | ATLXOMPMHXAQLD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|