C28H37ClN2O3 — CID 25003499
[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[2-(4-methylphenoxy)ethyl]azanium chloride (PubChem CID 25003499) has the molecular formula C28H37ClN2O3 and a molecular weight of 485.07 g/mol. Its IUPAC name is [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[2-(4-methylphenoxy)ethyl]azanium chloride.
| Compound Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[2-(4-methylphenoxy)ethyl]azanium chloride |
|---|---|
| PubChem CID | 25003499 |
| Molecular Formula | C28H37ClN2O3 |
| Molecular Weight | 485.07 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[2-(4-methylphenoxy)ethyl]azanium chloride |
| SMILES | Cc1ccc(OCC[N+](C)(C)Cc2cnc([C@](O)(c3ccccc3)C3CCCCC3)o2)cc1.[Cl-] |
| InChI | InChI=1S/C28H37N2O3.ClH/c1-22-14-16-25(17-15-22)32-19-18-30(2,3)21-26-20-29-27(33-26)28(31,23-10-6-4-7-11-23)24-12-8-5-9-13-24;/h4,6-7,10-11,14-17,20,24,31H,5,8-9,12-13,18-19,21H2,1-3H3;1H/q+1;/p-1/t28-;/m0./s1 |
| InChIKey | AGYBYZOWXWNDLP-JCOPYZAKSA-M |
| XLogP | 2.46 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.07 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|