C28H39N2O3+ — CID 163759935
[2-[(R)-cyclohexa-2,4-dien-1-yl-cyclohexyl-hydroxymethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium (PubChem CID 163759935) has the molecular formula C28H39N2O3+ and a molecular weight of 451.63 g/mol. Its IUPAC name is [2-[(R)-cyclohexa-2,4-dien-1-yl-cyclohexyl-hydroxymethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium.
| Compound Name | [2-[(R)-cyclohexa-2,4-dien-1-yl-cyclohexyl-hydroxymethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium |
|---|---|
| PubChem CID | 163759935 |
| Molecular Formula | C28H39N2O3+ |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | [2-[(R)-cyclohexa-2,4-dien-1-yl-cyclohexyl-hydroxymethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium |
| SMILES | C[N+](C)(CCCOc1ccccc1)Cc1cnc([C@](O)(C2C=CC=CC2)C2CCCCC2)o1 |
| InChI | InChI=1S/C28H39N2O3/c1-30(2,19-12-20-32-25-17-10-5-11-18-25)22-26-21-29-27(33-26)28(31,23-13-6-3-7-14-23)24-15-8-4-9-16-24/h3,5-7,10-11,13,17-18,21,23-24,31H,4,8-9,12,14-16,19-20,22H2,1-2H3/q+1/t23?,28-/m0/s1 |
| InChIKey | YNYOUBXPBGHUPH-WOKNPCPGSA-N |
| XLogP | 5.62 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|