C22H30N2O2 — CID 59317031
(S)-cyclohexyl-phenyl-[5-(piperidin-1-ylmethyl)-1,3-oxazol-2-yl]methanol (PubChem CID 59317031) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is (S)-cyclohexyl-phenyl-[5-(piperidin-1-ylmethyl)-1,3-oxazol-2-yl]methanol.
| Compound Name | (S)-cyclohexyl-phenyl-[5-(piperidin-1-ylmethyl)-1,3-oxazol-2-yl]methanol |
|---|---|
| PubChem CID | 59317031 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | (S)-cyclohexyl-phenyl-[5-(piperidin-1-ylmethyl)-1,3-oxazol-2-yl]methanol |
| SMILES | O[C@@](c1ccccc1)(c1ncc(CN2CCCCC2)o1)C1CCCCC1 |
| InChI | InChI=1S/C22H30N2O2/c25-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)21-23-16-20(26-21)17-24-14-8-3-9-15-24/h1,4-5,10-11,16,19,25H,2-3,6-9,12-15,17H2/t22-/m1/s1 |
| InChIKey | PNNABDZCZWBTHN-JOCHJYFZSA-N |
| XLogP | 4.48 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |