C18H22BrNO2 — CID 174589979
(S)-[5-(2-bromoethyl)-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanol (PubChem CID 174589979) has the molecular formula C18H22BrNO2 and a molecular weight of 364.28 g/mol. Its IUPAC name is (S)-[5-(2-bromoethyl)-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanol.
| Compound Name | (S)-[5-(2-bromoethyl)-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanol |
|---|---|
| PubChem CID | 174589979 |
| Molecular Formula | C18H22BrNO2 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (S)-[5-(2-bromoethyl)-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanol |
| SMILES | O[C@@](c1ccccc1)(c1ncc(CCBr)o1)C1CCCCC1 |
| InChI | InChI=1S/C18H22BrNO2/c19-12-11-16-13-20-17(22-16)18(21,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1,3-4,7-8,13,15,21H,2,5-6,9-12H2/t18-/m1/s1 |
| InChIKey | VSKFDESQGHQPLJ-GOSISDBHSA-N |
| XLogP | 4.43 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|