C29H35N3O4 — CID 87731028
3-[3-[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]propylamino]-N-(4-formylphenyl)propanamide (PubChem CID 87731028) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is 3-[3-[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]propylamino]-N-(4-formylphenyl)propanamide.
| Compound Name | 3-[3-[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]propylamino]-N-(4-formylphenyl)propanamide |
|---|---|
| PubChem CID | 87731028 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 3-[3-[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]propylamino]-N-(4-formylphenyl)propanamide |
| SMILES | O=Cc1ccc(NC(=O)CCNCCCc2cnc([C@](O)(c3ccccc3)C3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C29H35N3O4/c33-21-22-13-15-25(16-14-22)32-27(34)17-19-30-18-7-12-26-20-31-28(36-26)29(35,23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1,3-4,8-9,13-16,20-21,24,30,35H,2,5-7,10-12,17-19H2,(H,32,34)/t29-/m0/s1 |
| InChIKey | OEWIQIWTFFIIJE-LJAQVGFWSA-N |
| XLogP | 4.85 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|