C29H36N2O4 — CID 87721226
3-[3-[2-[2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]ethyl-methylamino]propoxy]benzaldehyde (PubChem CID 87721226) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is 3-[3-[2-[2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]ethyl-methylamino]propoxy]benzaldehyde.
| Compound Name | 3-[3-[2-[2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]ethyl-methylamino]propoxy]benzaldehyde |
|---|---|
| PubChem CID | 87721226 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 3-[3-[2-[2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]ethyl-methylamino]propoxy]benzaldehyde |
| SMILES | CN(CCCOc1cccc(C=O)c1)CCc1cnc(C(O)(c2ccccc2)C2CCCCC2)o1 |
| InChI | InChI=1S/C29H36N2O4/c1-31(17-9-19-34-26-15-8-10-23(20-26)22-32)18-16-27-21-30-28(35-27)29(33,24-11-4-2-5-12-24)25-13-6-3-7-14-25/h2,4-5,8,10-12,15,20-22,25,33H,3,6-7,9,13-14,16-19H2,1H3 |
| InChIKey | QWHXXHZSIMXAAU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|