C27H36N3O4S+ — CID 87721421
1-(benzenesulfonamido)ethyl-[[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl]-dimethylazanium (PubChem CID 87721421) has the molecular formula C27H36N3O4S+ and a molecular weight of 498.67 g/mol. Its IUPAC name is 1-(benzenesulfonamido)ethyl-[[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl]-dimethylazanium.
| Compound Name | 1-(benzenesulfonamido)ethyl-[[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 87721421 |
| Molecular Formula | C27H36N3O4S+ |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 1-(benzenesulfonamido)ethyl-[[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl]-dimethylazanium |
| SMILES | CC(NS(=O)(=O)c1ccccc1)[N+](C)(C)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1 |
| InChI | InChI=1S/C27H36N3O4S/c1-21(29-35(32,33)25-17-11-6-12-18-25)30(2,3)20-24-19-28-26(34-24)27(31,22-13-7-4-8-14-22)23-15-9-5-10-16-23/h4,6-8,11-14,17-19,21,23,29,31H,5,9-10,15-16,20H2,1-3H3/q+1/t21?,27-/m0/s1 |
| InChIKey | FFUQNHLAKBHETJ-YQAGWJQESA-N |
| XLogP | 4.39 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|