C28H37N2O4S+ — CID 87721272
1-(benzenesulfonyl)propyl-[[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl]-dimethylazanium (PubChem CID 87721272) has the molecular formula C28H37N2O4S+ and a molecular weight of 497.68 g/mol. Its IUPAC name is 1-(benzenesulfonyl)propyl-[[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl]-dimethylazanium.
| Compound Name | 1-(benzenesulfonyl)propyl-[[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 87721272 |
| Molecular Formula | C28H37N2O4S+ |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 1-(benzenesulfonyl)propyl-[[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl]-dimethylazanium |
| SMILES | CCC([N+](C)(C)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H37N2O4S/c1-4-26(35(32,33)25-18-12-7-13-19-25)30(2,3)21-24-20-29-27(34-24)28(31,22-14-8-5-9-15-22)23-16-10-6-11-17-23/h5,7-9,12-15,18-20,23,26,31H,4,6,10-11,16-17,21H2,1-3H3/q+1/t26?,28-/m0/s1 |
| InChIKey | BHZOMXWKPKKZPK-RXBHZZDJSA-N |
| XLogP | 5.28 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|