C30H30FN2O2S+ — CID 59226178
[5-[[(3R)-3-(4-fluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-diphenylmethanol (PubChem CID 59226178) has the molecular formula C30H30FN2O2S+ and a molecular weight of 501.65 g/mol. Its IUPAC name is [5-[[(3R)-3-(4-fluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-diphenylmethanol.
| Compound Name | [5-[[(3R)-3-(4-fluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 59226178 |
| Molecular Formula | C30H30FN2O2S+ |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | [5-[[(3R)-3-(4-fluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-diphenylmethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)c1ncc(C[N+]23CCC(CC2)[C@@H](Sc2ccc(F)cc2)C3)o1 |
| InChI | InChI=1S/C30H30FN2O2S/c31-25-11-13-27(14-12-25)36-28-21-33(17-15-22(28)16-18-33)20-26-19-32-29(35-26)30(34,23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-14,19,22,28,34H,15-18,20-21H2/q+1/t22?,28-,33?/m0/s1 |
| InChIKey | YVQCHLXRTXXGMI-IMEUCGBYSA-N |
| XLogP | 6.00 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|