C30H29F2N2O2S+ — CID 59226112
[5-[[(3R)-3-(3,4-difluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-diphenylmethanol (PubChem CID 59226112) has the molecular formula C30H29F2N2O2S+ and a molecular weight of 519.64 g/mol. Its IUPAC name is [5-[[(3R)-3-(3,4-difluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-diphenylmethanol.
| Compound Name | [5-[[(3R)-3-(3,4-difluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 59226112 |
| Molecular Formula | C30H29F2N2O2S+ |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | [5-[[(3R)-3-(3,4-difluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-diphenylmethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)c1ncc(C[N+]23CCC(CC2)[C@@H](Sc2ccc(F)c(F)c2)C3)o1 |
| InChI | InChI=1S/C30H29F2N2O2S/c31-26-12-11-25(17-27(26)32)37-28-20-34(15-13-21(28)14-16-34)19-24-18-33-29(36-24)30(35,22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-12,17-18,21,28,35H,13-16,19-20H2/q+1/t21?,28-,34?/m0/s1 |
| InChIKey | PWMJYUSAYGONBM-PSAYJESBSA-N |
| XLogP | 6.14 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|