C32H29ClF3NO2 — CID 87753753
4-[3-[(1-chloro-2,2,2-trifluoro-1-phenylethyl)-(1,1-diphenylethyl)amino]propoxy]benzaldehyde (PubChem CID 87753753) has the molecular formula C32H29ClF3NO2 and a molecular weight of 552.04 g/mol. Its IUPAC name is 4-[3-[(1-chloro-2,2,2-trifluoro-1-phenylethyl)-(1,1-diphenylethyl)amino]propoxy]benzaldehyde.
| Compound Name | 4-[3-[(1-chloro-2,2,2-trifluoro-1-phenylethyl)-(1,1-diphenylethyl)amino]propoxy]benzaldehyde |
|---|---|
| PubChem CID | 87753753 |
| Molecular Formula | C32H29ClF3NO2 |
| Molecular Weight | 552.04 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 4-[3-[(1-chloro-2,2,2-trifluoro-1-phenylethyl)-(1,1-diphenylethyl)amino]propoxy]benzaldehyde |
| SMILES | CC(c1ccccc1)(c1ccccc1)N(CCCOc1ccc(C=O)cc1)C(Cl)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C32H29ClF3NO2/c1-30(26-12-5-2-6-13-26,27-14-7-3-8-15-27)37(22-11-23-39-29-20-18-25(24-38)19-21-29)31(33,32(34,35)36)28-16-9-4-10-17-28/h2-10,12-21,24H,11,22-23H2,1H3 |
| InChIKey | SIIVZDRGDUKRBC-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.04 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|