C17H13N5O3S — CID 14673576
5-methoxy-3-phenoxy-N-(2H-tetrazol-5-yl)-1-benzothiophene-2-carboxamide (PubChem CID 14673576) has the molecular formula C17H13N5O3S and a molecular weight of 367.39 g/mol. Its IUPAC name is 5-methoxy-3-phenoxy-N-(2H-tetrazol-5-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-methoxy-3-phenoxy-N-(2H-tetrazol-5-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 14673576 |
| Molecular Formula | C17H13N5O3S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 5-methoxy-3-phenoxy-N-(2H-tetrazol-5-yl)-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2sc(C(=O)Nc3nn[nH]n3)c(Oc3ccccc3)c2c1 |
| InChI | InChI=1S/C17H13N5O3S/c1-24-11-7-8-13-12(9-11)14(25-10-5-3-2-4-6-10)15(26-13)16(23)18-17-19-21-22-20-17/h2-9H,1H3,(H2,18,19,20,21,22,23) |
| InChIKey | FSXREDDGKGXHPR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |