C17H19N5O3S2 — CID 69362214
(3-cyclohexylsulfanyl-5-methoxy-1-benzothiophen-2-yl) N-(2H-tetrazol-5-yl)carbamate (PubChem CID 69362214) has the molecular formula C17H19N5O3S2 and a molecular weight of 405.51 g/mol. Its IUPAC name is (3-cyclohexylsulfanyl-5-methoxy-1-benzothiophen-2-yl) N-(2H-tetrazol-5-yl)carbamate.
| Compound Name | (3-cyclohexylsulfanyl-5-methoxy-1-benzothiophen-2-yl) N-(2H-tetrazol-5-yl)carbamate |
|---|---|
| PubChem CID | 69362214 |
| Molecular Formula | C17H19N5O3S2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (3-cyclohexylsulfanyl-5-methoxy-1-benzothiophen-2-yl) N-(2H-tetrazol-5-yl)carbamate |
| SMILES | COc1ccc2sc(OC(=O)Nc3nn[nH]n3)c(SC3CCCCC3)c2c1 |
| InChI | InChI=1S/C17H19N5O3S2/c1-24-10-7-8-13-12(9-10)14(26-11-5-3-2-4-6-11)15(27-13)25-17(23)18-16-19-21-22-20-16/h7-9,11H,2-6H2,1H3,(H2,18,19,20,21,22,23) |
| InChIKey | PZWJBKQZAPYJBG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |