C19H23N5O4 — CID 11246122
3-cyclooctyloxy-5-methoxy-N-(2H-tetrazol-5-yl)-1-benzofuran-2-carboxamide (PubChem CID 11246122) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-cyclooctyloxy-5-methoxy-N-(2H-tetrazol-5-yl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-cyclooctyloxy-5-methoxy-N-(2H-tetrazol-5-yl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 11246122 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 3-cyclooctyloxy-5-methoxy-N-(2H-tetrazol-5-yl)-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)Nc3nn[nH]n3)c(OC3CCCCCCC3)c2c1 |
| InChI | InChI=1S/C19H23N5O4/c1-26-13-9-10-15-14(11-13)16(27-12-7-5-3-2-4-6-8-12)17(28-15)18(25)20-19-21-23-24-22-19/h9-12H,2-8H2,1H3,(H2,20,21,22,23,24,25) |
| InChIKey | ACJPXGZTNAZORD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 115.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |