C14H18N2O4 — CID 14674759
4-[(2S)-2-formylpyrrolidin-1-yl]-N-(furan-2-ylmethyl)-4-oxobutanamide (PubChem CID 14674759) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-[(2S)-2-formylpyrrolidin-1-yl]-N-(furan-2-ylmethyl)-4-oxobutanamide.
| Compound Name | 4-[(2S)-2-formylpyrrolidin-1-yl]-N-(furan-2-ylmethyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 14674759 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-[(2S)-2-formylpyrrolidin-1-yl]-N-(furan-2-ylmethyl)-4-oxobutanamide |
| SMILES | O=C[C@@H]1CCCN1C(=O)CCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H18N2O4/c17-10-11-3-1-7-16(11)14(19)6-5-13(18)15-9-12-4-2-8-20-12/h2,4,8,10-11H,1,3,5-7,9H2,(H,15,18)/t11-/m0/s1 |
| InChIKey | QTRDOMANGXJOHQ-NSHDSACASA-N |
| XLogP | 0.87 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|