C31H26FN5O3 — CID 146782304
methyl 4-[6-(2-amino-4-oxopent-2-en-3-yl)-1-[fluoro(dipyridin-2-yl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzoate (PubChem CID 146782304) has the molecular formula C31H26FN5O3 and a molecular weight of 535.58 g/mol. Its IUPAC name is methyl 4-[6-(2-amino-4-oxopent-2-en-3-yl)-1-[fluoro(dipyridin-2-yl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzoate.
| Compound Name | methyl 4-[6-(2-amino-4-oxopent-2-en-3-yl)-1-[fluoro(dipyridin-2-yl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzoate |
|---|---|
| PubChem CID | 146782304 |
| Molecular Formula | C31H26FN5O3 |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | methyl 4-[6-(2-amino-4-oxopent-2-en-3-yl)-1-[fluoro(dipyridin-2-yl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cn(C(F)(c3ccccn3)c3ccccn3)c3cc(C(C(C)=O)=C(C)N)cnc23)cc1 |
| InChI | InChI=1S/C31H26FN5O3/c1-19(33)28(20(2)38)23-16-25-29(36-17-23)24(21-10-12-22(13-11-21)30(39)40-3)18-37(25)31(32,26-8-4-6-14-34-26)27-9-5-7-15-35-27/h4-18H,33H2,1-3H3 |
| InChIKey | CLBBQPCRXOZTGO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|