C8H10N2 — CID 146800823
6,6-dimethyl-1,4-diazacycloocta-2,4,7,8-tetraene (PubChem CID 146800823) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 6,6-dimethyl-1,4-diazacycloocta-2,4,7,8-tetraene.
| Compound Name | 6,6-dimethyl-1,4-diazacycloocta-2,4,7,8-tetraene |
|---|---|
| PubChem CID | 146800823 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 6,6-dimethyl-1,4-diazacycloocta-2,4,7,8-tetraene |
| SMILES | CC1(C)C=C=NC=C/N=C\1 |
| InChI | InChI=1S/C8H10N2/c1-8(2)3-4-9-5-6-10-7-8/h3,5-7H,1-2H3/b6-5?,10-7- |
| InChIKey | RXVYTPMXZSPHLY-NMVVBPQGSA-N |
| XLogP | 1.79 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |