C26H38F2INO4 — CID 14681394
ethyl (2R,4R,5R)-6-cyclohexyl-3,3-difluoro-4-iodo-2-(2-methylpropyl)-5-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 14681394) has the molecular formula C26H38F2INO4 and a molecular weight of 593.49 g/mol. Its IUPAC name is ethyl (2R,4R,5R)-6-cyclohexyl-3,3-difluoro-4-iodo-2-(2-methylpropyl)-5-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | ethyl (2R,4R,5R)-6-cyclohexyl-3,3-difluoro-4-iodo-2-(2-methylpropyl)-5-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 14681394 |
| Molecular Formula | C26H38F2INO4 |
| Molecular Weight | 593.49 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | ethyl (2R,4R,5R)-6-cyclohexyl-3,3-difluoro-4-iodo-2-(2-methylpropyl)-5-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCOC(=O)[C@@H](CC(C)C)C(F)(F)[C@H](I)[C@@H](CC1CCCCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H38F2INO4/c1-4-33-24(31)21(15-18(2)3)26(27,28)23(29)22(16-19-11-7-5-8-12-19)30-25(32)34-17-20-13-9-6-10-14-20/h6,9-10,13-14,18-19,21-23H,4-5,7-8,11-12,15-17H2,1-3H3,(H,30,32)/t21-,22-,23-/m1/s1 |
| InChIKey | UKEIKAQKDZLEDJ-DNVJHFABSA-N |
| XLogP | 6.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.49 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|