C20H20FNO4 — CID 46846088
benzyl N-[[(3S,4R)-4-(4-fluorophenyl)-6-oxooxan-3-yl]methyl]carbamate (PubChem CID 46846088) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is benzyl N-[[(3S,4R)-4-(4-fluorophenyl)-6-oxooxan-3-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(3S,4R)-4-(4-fluorophenyl)-6-oxooxan-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 46846088 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | benzyl N-[[(3S,4R)-4-(4-fluorophenyl)-6-oxooxan-3-yl]methyl]carbamate |
| SMILES | O=C1C[C@@H](c2ccc(F)cc2)[C@@H](CNC(=O)OCc2ccccc2)CO1 |
| InChI | InChI=1S/C20H20FNO4/c21-17-8-6-15(7-9-17)18-10-19(23)25-13-16(18)11-22-20(24)26-12-14-4-2-1-3-5-14/h1-9,16,18H,10-13H2,(H,22,24)/t16-,18-/m0/s1 |
| InChIKey | HWQXKMNKRCFJAM-WMZOPIPTSA-N |
| XLogP | 3.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |