C22H29FO4S — CID 146826577
1-[4-(1-adamantylmethoxy)-5-ethyl-2-fluorophenyl]-2-methylsulfonylethanone (PubChem CID 146826577) has the molecular formula C22H29FO4S and a molecular weight of 408.54 g/mol. Its IUPAC name is 1-[4-(1-adamantylmethoxy)-5-ethyl-2-fluorophenyl]-2-methylsulfonylethanone.
| Compound Name | 1-[4-(1-adamantylmethoxy)-5-ethyl-2-fluorophenyl]-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 146826577 |
| Molecular Formula | C22H29FO4S |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[4-(1-adamantylmethoxy)-5-ethyl-2-fluorophenyl]-2-methylsulfonylethanone |
| SMILES | CCc1cc(C(=O)CS(C)(=O)=O)c(F)cc1OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H29FO4S/c1-3-17-7-18(20(24)12-28(2,25)26)19(23)8-21(17)27-13-22-9-14-4-15(10-22)6-16(5-14)11-22/h7-8,14-16H,3-6,9-13H2,1-2H3 |
| InChIKey | SDBXQCNGZVGZQN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |