C26H18N2O4S — CID 146839048
(3Z)-3-[[5-methoxy-1-(naphthalene-2-carbonyl)indol-3-yl]methylidene]-6-sulfanylidenepiperidine-2,4-dione (PubChem CID 146839048) has the molecular formula C26H18N2O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is (3Z)-3-[[5-methoxy-1-(naphthalene-2-carbonyl)indol-3-yl]methylidene]-6-sulfanylidenepiperidine-2,4-dione.
| Compound Name | (3Z)-3-[[5-methoxy-1-(naphthalene-2-carbonyl)indol-3-yl]methylidene]-6-sulfanylidenepiperidine-2,4-dione |
|---|---|
| PubChem CID | 146839048 |
| Molecular Formula | C26H18N2O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | (3Z)-3-[[5-methoxy-1-(naphthalene-2-carbonyl)indol-3-yl]methylidene]-6-sulfanylidenepiperidine-2,4-dione |
| SMILES | COc1ccc2c(c1)c(/C=C1/C(=O)CC(=S)NC1=O)cn2C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H18N2O4S/c1-32-19-8-9-22-20(12-19)18(11-21-23(29)13-24(33)27-25(21)30)14-28(22)26(31)17-7-6-15-4-2-3-5-16(15)10-17/h2-12,14H,13H2,1H3,(H,27,30,33)/b21-11- |
| InChIKey | SFRJUUQIRNQSBW-NHDPSOOVSA-N |
| XLogP | 4.29 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|