C24H14BrN3O3S — CID 71562019
5-[[5-bromo-1-(naphthalene-1-carbonyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 71562019) has the molecular formula C24H14BrN3O3S and a molecular weight of 504.37 g/mol. Its IUPAC name is 5-[[5-bromo-1-(naphthalene-1-carbonyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[5-bromo-1-(naphthalene-1-carbonyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 71562019 |
| Molecular Formula | C24H14BrN3O3S |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | 5-[[5-bromo-1-(naphthalene-1-carbonyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1cn(C(=O)c2cccc3ccccc23)c2ccc(Br)cc12 |
| InChI | InChI=1S/C24H14BrN3O3S/c25-15-8-9-20-18(11-15)14(10-19-21(29)26-24(32)27-22(19)30)12-28(20)23(31)17-7-3-5-13-4-1-2-6-16(13)17/h1-12H,(H2,26,27,29,30,32) |
| InChIKey | HAATXHHNAFKKOB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|