C27H16N4O4S — CID 86575547
5-[[3-(2-oxobenzo[h]chromen-3-yl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 86575547) has the molecular formula C27H16N4O4S and a molecular weight of 492.52 g/mol. Its IUPAC name is 5-[[3-(2-oxobenzo[h]chromen-3-yl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[3-(2-oxobenzo[h]chromen-3-yl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 86575547 |
| Molecular Formula | C27H16N4O4S |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 5-[[3-(2-oxobenzo[h]chromen-3-yl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1cn(-c2ccccc2)nc1-c1cc2ccc3ccccc3c2oc1=O |
| InChI | InChI=1S/C27H16N4O4S/c32-24-21(25(33)29-27(36)28-24)13-17-14-31(18-7-2-1-3-8-18)30-22(17)20-12-16-11-10-15-6-4-5-9-19(15)23(16)35-26(20)34/h1-14H,(H2,28,29,32,33,36) |
| InChIKey | QWFFPECBWVQBEX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|