C26H26N4O6 — CID 45123635
acetic acid;5-[[3-(2-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 45123635) has the molecular formula C26H26N4O6 and a molecular weight of 490.52 g/mol. Its IUPAC name is acetic acid;5-[[3-(2-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | acetic acid;5-[[3-(2-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 45123635 |
| Molecular Formula | C26H26N4O6 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | acetic acid;5-[[3-(2-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=O)O.CCCOc1ccc(-c2nn(-c3ccccc3)cc2C=C2C(=O)NC(=O)NC2=O)c(C)c1 |
| InChI | InChI=1S/C24H22N4O4.C2H4O2/c1-3-11-32-18-9-10-19(15(2)12-18)21-16(13-20-22(29)25-24(31)26-23(20)30)14-28(27-21)17-7-5-4-6-8-17;1-2(3)4/h4-10,12-14H,3,11H2,1-2H3,(H2,25,26,29,30,31);1H3,(H,3,4) |
| InChIKey | QAFKZEKIWYUECI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|