C25H20BrF4N3O3 — CID 146840453
5-[3-bromo-2-(2-methoxyethoxymethyl)imidazo[1,2-a]pyridin-8-yl]-N-(4-fluorophenyl)-2-(trifluoromethyl)benzamide (PubChem CID 146840453) has the molecular formula C25H20BrF4N3O3 and a molecular weight of 566.35 g/mol. Its IUPAC name is 5-[3-bromo-2-(2-methoxyethoxymethyl)imidazo[1,2-a]pyridin-8-yl]-N-(4-fluorophenyl)-2-(trifluoromethyl)benzamide.
| Compound Name | 5-[3-bromo-2-(2-methoxyethoxymethyl)imidazo[1,2-a]pyridin-8-yl]-N-(4-fluorophenyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 146840453 |
| Molecular Formula | C25H20BrF4N3O3 |
| Molecular Weight | 566.35 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | 5-[3-bromo-2-(2-methoxyethoxymethyl)imidazo[1,2-a]pyridin-8-yl]-N-(4-fluorophenyl)-2-(trifluoromethyl)benzamide |
| SMILES | COCCOCc1nc2c(-c3ccc(C(F)(F)F)c(C(=O)Nc4ccc(F)cc4)c3)cccn2c1Br |
| InChI | InChI=1S/C25H20BrF4N3O3/c1-35-11-12-36-14-21-22(26)33-10-2-3-18(23(33)32-21)15-4-9-20(25(28,29)30)19(13-15)24(34)31-17-7-5-16(27)6-8-17/h2-10,13H,11-12,14H2,1H3,(H,31,34) |
| InChIKey | SGAODMNLLMVCPS-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.35 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|