About CID 146855356
CID 146855356 (PubChem CID 146855356) has the molecular formula C3H6IO3S-
and a molecular weight of 249.05 g/mol.
Molecular Properties
| Compound Name | CID 146855356 |
| PubChem CID | 146855356 |
| Molecular Formula | C3H6IO3S- |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 248.91 |
| IUPAC Name | — |
| SMILES | O=S1(=O)CCC[I-]O1 |
| InChI | InChI=1S/C3H6IO3S/c5-8(6)3-1-2-4-7-8/h1-3H2/q-1 |
| InChIKey | UGSGPGQSJVJJMZ-UHFFFAOYSA-N |
| XLogP | -3.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 146855356 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146855356?
The IUPAC name of CID 146855356 (CID 146855356) is not available.
What is the SMILES notation for CID 146855356?
The canonical SMILES for CID 146855356 is O=S1(=O)CCC[I-]O1.
What is the InChIKey of CID 146855356?
The InChIKey is UGSGPGQSJVJJMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6IO3S/c5-8(6)3-1-2-4-7-8/h1-3H2/q-1.
What are the key properties of CID 146855356?
CID 146855356 has a molecular weight of 249.05 g/mol, XLogP of -3.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146855356 is sourced from PubChem (CID 146855356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).