C11H23N5 — CID 146868799
1-(2-aminopropan-2-yl)-3-[1-(dimethylamino)ethenyl]-2-prop-2-enylguanidine (PubChem CID 146868799) has the molecular formula C11H23N5 and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-(2-aminopropan-2-yl)-3-[1-(dimethylamino)ethenyl]-2-prop-2-enylguanidine.
| Compound Name | 1-(2-aminopropan-2-yl)-3-[1-(dimethylamino)ethenyl]-2-prop-2-enylguanidine |
|---|---|
| PubChem CID | 146868799 |
| Molecular Formula | C11H23N5 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.20 |
| IUPAC Name | 1-(2-aminopropan-2-yl)-3-[1-(dimethylamino)ethenyl]-2-prop-2-enylguanidine |
| SMILES | C=CC/N=C(\NC(=C)N(C)C)NC(C)(C)N |
| InChI | InChI=1S/C11H23N5/c1-7-8-13-10(15-11(3,4)12)14-9(2)16(5)6/h7H,1-2,8,12H2,3-6H3,(H2,13,14,15) |
| InChIKey | SNKOCJOWZXVWFH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|