C21H26O8 — CID 14687004
diethyl 4,8-dihydroxy-3,9-dimethyl-2,10-dioxatetracyclo[6.5.2.04,14.011,15]pentadeca-1(14),11(15),12-triene-3,9-dicarboxylate (PubChem CID 14687004) has the molecular formula C21H26O8 and a molecular weight of 406.43 g/mol. Its IUPAC name is diethyl 4,8-dihydroxy-3,9-dimethyl-2,10-dioxatetracyclo[6.5.2.04,14.011,15]pentadeca-1(14),11(15),12-triene-3,9-dicarboxylate.
| Compound Name | diethyl 4,8-dihydroxy-3,9-dimethyl-2,10-dioxatetracyclo[6.5.2.04,14.011,15]pentadeca-1(14),11(15),12-triene-3,9-dicarboxylate |
|---|---|
| PubChem CID | 14687004 |
| Molecular Formula | C21H26O8 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | diethyl 4,8-dihydroxy-3,9-dimethyl-2,10-dioxatetracyclo[6.5.2.04,14.011,15]pentadeca-1(14),11(15),12-triene-3,9-dicarboxylate |
| SMILES | CCOC(=O)C1(C)Oc2ccc3c4c2C1(O)CCCC4(O)C(C)(C(=O)OCC)O3 |
| InChI | InChI=1S/C21H26O8/c1-5-26-16(22)18(3)20(24)10-7-11-21(25)15-13(9-8-12(28-18)14(15)20)29-19(21,4)17(23)27-6-2/h8-9,24-25H,5-7,10-11H2,1-4H3 |
| InChIKey | WPXJQFLZAPVBNL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |