C21H22O6 — CID 14686998
diethyl 3,9-dimethyl-2,10-dioxatetracyclo[6.5.2.04,14.011,15]pentadeca-1(14),4,7,11(15),12-pentaene-3,9-dicarboxylate (PubChem CID 14686998) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is diethyl 3,9-dimethyl-2,10-dioxatetracyclo[6.5.2.04,14.011,15]pentadeca-1(14),4,7,11(15),12-pentaene-3,9-dicarboxylate.
| Compound Name | diethyl 3,9-dimethyl-2,10-dioxatetracyclo[6.5.2.04,14.011,15]pentadeca-1(14),4,7,11(15),12-pentaene-3,9-dicarboxylate |
|---|---|
| PubChem CID | 14686998 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | diethyl 3,9-dimethyl-2,10-dioxatetracyclo[6.5.2.04,14.011,15]pentadeca-1(14),4,7,11(15),12-pentaene-3,9-dicarboxylate |
| SMILES | CCOC(=O)C1(C)Oc2ccc3c4c2C1=CCC=C4C(C)(C(=O)OCC)O3 |
| InChI | InChI=1S/C21H22O6/c1-5-24-18(22)20(3)12-8-7-9-13-17-15(11-10-14(26-20)16(12)17)27-21(13,4)19(23)25-6-2/h8-11H,5-7H2,1-4H3 |
| InChIKey | QMOHGZGJFWRELB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |