C29H31N7O3S — CID 146874256
1-[[1-(cyclopropylmethyl)-3-morpholin-4-ylpyrazole-4-carbonyl]amino]-3-(4-oxo-1-phenyl-3,5-dihydro-2-benzazepin-3-yl)thiourea (PubChem CID 146874256) has the molecular formula C29H31N7O3S and a molecular weight of 557.68 g/mol. Its IUPAC name is 1-[[1-(cyclopropylmethyl)-3-morpholin-4-ylpyrazole-4-carbonyl]amino]-3-(4-oxo-1-phenyl-3,5-dihydro-2-benzazepin-3-yl)thiourea.
| Compound Name | 1-[[1-(cyclopropylmethyl)-3-morpholin-4-ylpyrazole-4-carbonyl]amino]-3-(4-oxo-1-phenyl-3,5-dihydro-2-benzazepin-3-yl)thiourea |
|---|---|
| PubChem CID | 146874256 |
| Molecular Formula | C29H31N7O3S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 1-[[1-(cyclopropylmethyl)-3-morpholin-4-ylpyrazole-4-carbonyl]amino]-3-(4-oxo-1-phenyl-3,5-dihydro-2-benzazepin-3-yl)thiourea |
| SMILES | O=C(NNC(=S)NC1N=C(c2ccccc2)c2ccccc2CC1=O)c1cn(CC2CC2)nc1N1CCOCC1 |
| InChI | InChI=1S/C29H31N7O3S/c37-24-16-21-8-4-5-9-22(21)25(20-6-2-1-3-7-20)30-26(24)31-29(40)33-32-28(38)23-18-36(17-19-10-11-19)34-27(23)35-12-14-39-15-13-35/h1-9,18-19,26H,10-17H2,(H,32,38)(H2,31,33,40) |
| InChIKey | SPESTXZFVHXEKG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|