C25H21F3N4O2 — CID 149041398
1-phenyl-3-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)amino]-3,5-dihydro-2-benzazepin-4-one (PubChem CID 149041398) has the molecular formula C25H21F3N4O2 and a molecular weight of 466.46 g/mol. Its IUPAC name is 1-phenyl-3-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)amino]-3,5-dihydro-2-benzazepin-4-one.
| Compound Name | 1-phenyl-3-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)amino]-3,5-dihydro-2-benzazepin-4-one |
|---|---|
| PubChem CID | 149041398 |
| Molecular Formula | C25H21F3N4O2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-phenyl-3-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)amino]-3,5-dihydro-2-benzazepin-4-one |
| SMILES | O=C1Cc2ccccc2C(c2ccccc2)=NC1Nc1c(F)c(F)nc(N2CCOCC2)c1F |
| InChI | InChI=1S/C25H21F3N4O2/c26-19-22(20(27)25(31-23(19)28)32-10-12-34-13-11-32)30-24-18(33)14-16-8-4-5-9-17(16)21(29-24)15-6-2-1-3-7-15/h1-9,24H,10-14H2,(H,30,31) |
| InChIKey | QHQOJXVGGTXYNI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|