C22H15BrF3N3O — CID 162104957
1-(4-bromophenyl)-3-[(2,3,5-trifluoro-6-methyl-4-pyridinyl)amino]-3,5-dihydro-2-benzazepin-4-one (PubChem CID 162104957) has the molecular formula C22H15BrF3N3O and a molecular weight of 474.28 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(2,3,5-trifluoro-6-methyl-4-pyridinyl)amino]-3,5-dihydro-2-benzazepin-4-one.
| Compound Name | 1-(4-bromophenyl)-3-[(2,3,5-trifluoro-6-methyl-4-pyridinyl)amino]-3,5-dihydro-2-benzazepin-4-one |
|---|---|
| PubChem CID | 162104957 |
| Molecular Formula | C22H15BrF3N3O |
| Molecular Weight | 474.28 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(2,3,5-trifluoro-6-methyl-4-pyridinyl)amino]-3,5-dihydro-2-benzazepin-4-one |
| SMILES | Cc1nc(F)c(F)c(NC2N=C(c3ccc(Br)cc3)c3ccccc3CC2=O)c1F |
| InChI | InChI=1S/C22H15BrF3N3O/c1-11-17(24)20(18(25)21(26)27-11)29-22-16(30)10-13-4-2-3-5-15(13)19(28-22)12-6-8-14(23)9-7-12/h2-9,22H,10H2,1H3,(H,27,29) |
| InChIKey | WWEUKXNJFOBVKL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|