C21H13F4N3O — CID 159400397
1-phenyl-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-3,5-dihydro-2-benzazepin-4-one (PubChem CID 159400397) has the molecular formula C21H13F4N3O and a molecular weight of 399.35 g/mol. Its IUPAC name is 1-phenyl-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-3,5-dihydro-2-benzazepin-4-one.
| Compound Name | 1-phenyl-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-3,5-dihydro-2-benzazepin-4-one |
|---|---|
| PubChem CID | 159400397 |
| Molecular Formula | C21H13F4N3O |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 1-phenyl-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-3,5-dihydro-2-benzazepin-4-one |
| SMILES | O=C1Cc2ccccc2C(c2ccccc2)=NC1Nc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C21H13F4N3O/c22-15-18(16(23)20(25)28-19(15)24)27-21-14(29)10-12-8-4-5-9-13(12)17(26-21)11-6-2-1-3-7-11/h1-9,21H,10H2,(H,27,28) |
| InChIKey | LNGMVBLGZFOZQP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|