C22H26N10O12P2 — CID 146890253
(6R,9S,17R,19R)-9,19-bis(6-aminopurin-9-yl)-3,14-dihydroxy-3,14-dioxo-2,4,7,12,15,18-hexaoxa-3λ5,14λ5-diphosphatetracyclo[15.2.1.06,11.08,10]icosane-8,20-diol (PubChem CID 146890253) has the molecular formula C22H26N10O12P2 and a molecular weight of 684.46 g/mol. Its IUPAC name is (6R,9S,17R,19R)-9,19-bis(6-aminopurin-9-yl)-3,14-dihydroxy-3,14-dioxo-2,4,7,12,15,18-hexaoxa-3λ5,14λ5-diphosphatetracyclo[15.2.1.06,11.08,10]icosane-8,20-diol.
| Compound Name | (6R,9S,17R,19R)-9,19-bis(6-aminopurin-9-yl)-3,14-dihydroxy-3,14-dioxo-2,4,7,12,15,18-hexaoxa-3λ5,14λ5-diphosphatetracyclo[15.2.1.06,11.08,10]icosane-8,20-diol |
|---|---|
| PubChem CID | 146890253 |
| Molecular Formula | C22H26N10O12P2 |
| Molecular Weight | 684.46 g/mol |
| Exact Mass | 684.12 |
| IUPAC Name | (6R,9S,17R,19R)-9,19-bis(6-aminopurin-9-yl)-3,14-dihydroxy-3,14-dioxo-2,4,7,12,15,18-hexaoxa-3λ5,14λ5-diphosphatetracyclo[15.2.1.06,11.08,10]icosane-8,20-diol |
| SMILES | Nc1ncnc2c1ncn2C1C2C3OCP(=O)(O)OC[C@H]4O[C@@H](n5cnc6c(N)ncnc65)C(OP(=O)(O)OC[C@H]3OC21O)C4O |
| InChI | InChI=1S/C22H26N10O12P2/c23-17-11-19(27-3-25-17)31(5-29-11)16-10-14-9(43-22(10,16)34)2-41-46(37,38)44-15-13(33)8(1-40-45(35,36)7-39-14)42-21(15)32-6-30-12-18(24)26-4-28-20(12)32/h3-6,8-10,13-16,21,33-34H,1-2,7H2,(H,35,36)(H,37,38)(H2,23,25,27)(H2,24,26,28)/t8-,9-,10?,13?,14?,15?,16?,21-,22?/m1/s1 |
| InChIKey | SZBGGHZGROIXJW-GFACBMGJSA-N |
| XLogP | -1.59 |
| TPSA | 309.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.46 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|