C12H23N3O3S — CID 146905742
2-[3-amino-2-methyl-4-(4-methylpiperazin-1-yl)-4-oxobutan-2-yl]sulfanylacetic acid (PubChem CID 146905742) has the molecular formula C12H23N3O3S and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-[3-amino-2-methyl-4-(4-methylpiperazin-1-yl)-4-oxobutan-2-yl]sulfanylacetic acid.
| Compound Name | 2-[3-amino-2-methyl-4-(4-methylpiperazin-1-yl)-4-oxobutan-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 146905742 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-[3-amino-2-methyl-4-(4-methylpiperazin-1-yl)-4-oxobutan-2-yl]sulfanylacetic acid |
| SMILES | CN1CCN(C(=O)C(N)C(C)(C)SCC(=O)O)CC1 |
| InChI | InChI=1S/C12H23N3O3S/c1-12(2,19-8-9(16)17)10(13)11(18)15-6-4-14(3)5-7-15/h10H,4-8,13H2,1-3H3,(H,16,17) |
| InChIKey | AAIKFVHJQZKZIW-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |