C30H33NO2 — CID 146916690
1,7-diphenyl-4-(4-piperidin-1-ylphenyl)heptane-2,6-dione (PubChem CID 146916690) has the molecular formula C30H33NO2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 1,7-diphenyl-4-(4-piperidin-1-ylphenyl)heptane-2,6-dione.
| Compound Name | 1,7-diphenyl-4-(4-piperidin-1-ylphenyl)heptane-2,6-dione |
|---|---|
| PubChem CID | 146916690 |
| Molecular Formula | C30H33NO2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 1,7-diphenyl-4-(4-piperidin-1-ylphenyl)heptane-2,6-dione |
| SMILES | O=C(Cc1ccccc1)CC(CC(=O)Cc1ccccc1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C30H33NO2/c32-29(20-24-10-4-1-5-11-24)22-27(23-30(33)21-25-12-6-2-7-13-25)26-14-16-28(17-15-26)31-18-8-3-9-19-31/h1-2,4-7,10-17,27H,3,8-9,18-23H2 |
| InChIKey | ACJDKQQBRNTXMD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|