C8H5IN2O3 — CID 146918099
4-[(E)-2-nitroethenyl]-8λ3-ioda-7-oxa-9-azabicyclo[4.3.0]nona-1(6),2,4,8-tetraene (PubChem CID 146918099) has the molecular formula C8H5IN2O3 and a molecular weight of 304.04 g/mol. Its IUPAC name is 4-[(E)-2-nitroethenyl]-8λ3-ioda-7-oxa-9-azabicyclo[4.3.0]nona-1(6),2,4,8-tetraene.
| Compound Name | 4-[(E)-2-nitroethenyl]-8λ3-ioda-7-oxa-9-azabicyclo[4.3.0]nona-1(6),2,4,8-tetraene |
|---|---|
| PubChem CID | 146918099 |
| Molecular Formula | C8H5IN2O3 |
| Molecular Weight | 304.04 g/mol |
| Exact Mass | 303.93 |
| IUPAC Name | 4-[(E)-2-nitroethenyl]-8λ3-ioda-7-oxa-9-azabicyclo[4.3.0]nona-1(6),2,4,8-tetraene |
| SMILES | O=[N+]([O-])/C=C/c1ccc2c(c1)OI=N2 |
| InChI | InChI=1S/C8H5IN2O3/c12-11(13)4-3-6-1-2-7-8(5-6)14-9-10-7/h1-5H/b4-3+ |
| InChIKey | ACPXTBHRGHIABB-ONEGZZNKSA-N |
| XLogP | 3.03 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.04 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|