C10H10N2O3 — CID 163985719
3-methyl-6-[(E)-2-nitroethenyl]-2H-1,3-benzoxazole (PubChem CID 163985719) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-methyl-6-[(E)-2-nitroethenyl]-2H-1,3-benzoxazole.
| Compound Name | 3-methyl-6-[(E)-2-nitroethenyl]-2H-1,3-benzoxazole |
|---|---|
| PubChem CID | 163985719 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-methyl-6-[(E)-2-nitroethenyl]-2H-1,3-benzoxazole |
| SMILES | CN1COc2cc(/C=C/[N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C10H10N2O3/c1-11-7-15-10-6-8(2-3-9(10)11)4-5-12(13)14/h2-6H,7H2,1H3/b5-4+ |
| InChIKey | TWCYGULXCBRGGO-SNAWJCMRSA-N |
| XLogP | 1.72 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|