C16H22FNO3S — CID 146926680
N-[(1R,2S)-1-(4-cyclopentylsulfonylphenyl)-3-fluoro-1-methoxypropan-2-yl]methanimine (PubChem CID 146926680) has the molecular formula C16H22FNO3S and a molecular weight of 327.42 g/mol. Its IUPAC name is N-[(1R,2S)-1-(4-cyclopentylsulfonylphenyl)-3-fluoro-1-methoxypropan-2-yl]methanimine.
| Compound Name | N-[(1R,2S)-1-(4-cyclopentylsulfonylphenyl)-3-fluoro-1-methoxypropan-2-yl]methanimine |
|---|---|
| PubChem CID | 146926680 |
| Molecular Formula | C16H22FNO3S |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[(1R,2S)-1-(4-cyclopentylsulfonylphenyl)-3-fluoro-1-methoxypropan-2-yl]methanimine |
| SMILES | C=N[C@H](CF)[C@H](OC)c1ccc(S(=O)(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C16H22FNO3S/c1-18-15(11-17)16(21-2)12-7-9-14(10-8-12)22(19,20)13-5-3-4-6-13/h7-10,13,15-16H,1,3-6,11H2,2H3/t15-,16-/m1/s1 |
| InChIKey | AEFCESAYBDOUJJ-HZPDHXFCSA-N |
| XLogP | 3.13 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|