C17H17F7N2S2 — CID 146931168
3-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-4,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,3-thiazol-2-imine (PubChem CID 146931168) has the molecular formula C17H17F7N2S2 and a molecular weight of 446.46 g/mol. Its IUPAC name is 3-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-4,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-4,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 146931168 |
| Molecular Formula | C17H17F7N2S2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 3-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-4,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,3-thiazol-2-imine |
| SMILES | Cc1cc(F)c(-n2c(C)c(C)s/c2=N\CCC(F)(F)F)cc1SCC(F)(F)F |
| InChI | InChI=1S/C17H17F7N2S2/c1-9-6-12(18)13(7-14(9)27-8-17(22,23)24)26-10(2)11(3)28-15(26)25-5-4-16(19,20)21/h6-7H,4-5,8H2,1-3H3/b25-15- |
| InChIKey | AFAVYACMZWVCQL-MYYYXRDXSA-N |
| XLogP | 6.11 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|