C13H10F7N3S — CID 89320644
N-[4-cyano-2-fluoro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-N'-ethyl-2,2,2-trifluoroethanimidamide (PubChem CID 89320644) has the molecular formula C13H10F7N3S and a molecular weight of 373.30 g/mol. Its IUPAC name is N-[4-cyano-2-fluoro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-N'-ethyl-2,2,2-trifluoroethanimidamide.
| Compound Name | N-[4-cyano-2-fluoro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-N'-ethyl-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 89320644 |
| Molecular Formula | C13H10F7N3S |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | N-[4-cyano-2-fluoro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-N'-ethyl-2,2,2-trifluoroethanimidamide |
| SMILES | CC/N=C(/Nc1cc(SCC(F)(F)F)c(C#N)cc1F)C(F)(F)F |
| InChI | InChI=1S/C13H10F7N3S/c1-2-22-11(13(18,19)20)23-9-4-10(24-6-12(15,16)17)7(5-21)3-8(9)14/h3-4H,2,6H2,1H3,(H,22,23) |
| InChIKey | ULWGYDNDYVSMSL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|