About 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one
1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one (PubChem CID 146935171) has the molecular formula C12H22INO2
and a molecular weight of 339.22 g/mol. Its IUPAC name is 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one.
Molecular Properties
| Compound Name | 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one |
| PubChem CID | 146935171 |
| Molecular Formula | C12H22INO2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one |
| SMILES | COCC1C[C@@H](I)N(C(=O)C(C)C(C)C)C1 |
| InChI | InChI=1S/C12H22INO2/c1-8(2)9(3)12(15)14-6-10(7-16-4)5-11(14)13/h8-11H,5-7H2,1-4H3/t9?,10?,11-/m0/s1 |
| InChIKey | AFUAENTWXJPAPS-ILDUYXDCSA-N |
| XLogP | 2.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one?
The IUPAC name of 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one (CID 146935171) is 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one.
What is the SMILES notation for 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one?
The canonical SMILES for 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one is COCC1C[C@@H](I)N(C(=O)C(C)C(C)C)C1.
What is the InChIKey of 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one?
The InChIKey is AFUAENTWXJPAPS-ILDUYXDCSA-N. The full InChI is InChI=1S/C12H22INO2/c1-8(2)9(3)12(15)14-6-10(7-16-4)5-11(14)13/h8-11H,5-7H2,1-4H3/t9?,10?,11-/m0/s1.
What are the key properties of 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one?
1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one has a molecular weight of 339.22 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one is sourced from PubChem (CID 146935171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).