C12H22INO2 — CID 146935171
1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one (PubChem CID 146935171) has the molecular formula C12H22INO2 and a molecular weight of 339.22 g/mol. Its IUPAC name is 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one.
| Compound Name | 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 146935171 |
| Molecular Formula | C12H22INO2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-2,3-dimethylbutan-1-one |
| SMILES | COCC1C[C@@H](I)N(C(=O)C(C)C(C)C)C1 |
| InChI | InChI=1S/C12H22INO2/c1-8(2)9(3)12(15)14-6-10(7-16-4)5-11(14)13/h8-11H,5-7H2,1-4H3/t9?,10?,11-/m0/s1 |
| InChIKey | AFUAENTWXJPAPS-ILDUYXDCSA-N |
| XLogP | 2.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|