C12H22INO3 — CID 147941866
1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-3-methoxy-2-methylbutan-1-one (PubChem CID 147941866) has the molecular formula C12H22INO3 and a molecular weight of 355.22 g/mol. Its IUPAC name is 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-3-methoxy-2-methylbutan-1-one.
| Compound Name | 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-3-methoxy-2-methylbutan-1-one |
|---|---|
| PubChem CID | 147941866 |
| Molecular Formula | C12H22INO3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 1-[(2R)-2-iodo-4-(methoxymethyl)pyrrolidin-1-yl]-3-methoxy-2-methylbutan-1-one |
| SMILES | COCC1C[C@@H](I)N(C(=O)C(C)C(C)OC)C1 |
| InChI | InChI=1S/C12H22INO3/c1-8(9(2)17-4)12(15)14-6-10(7-16-3)5-11(14)13/h8-11H,5-7H2,1-4H3/t8?,9?,10?,11-/m0/s1 |
| InChIKey | ILXJQLGBQQPUDE-QUBJWBRDSA-N |
| XLogP | 1.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|