C17H12FIN4O — CID 146949330
6-[[2-fluoro-4-(1-iodopyrazol-4-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 146949330) has the molecular formula C17H12FIN4O and a molecular weight of 434.21 g/mol. Its IUPAC name is 6-[[2-fluoro-4-(1-iodopyrazol-4-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-[[2-fluoro-4-(1-iodopyrazol-4-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 146949330 |
| Molecular Formula | C17H12FIN4O |
| Molecular Weight | 434.21 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 6-[[2-fluoro-4-(1-iodopyrazol-4-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1c2cccnc2CN1Cc1ccc(-c2cnn(I)c2)cc1F |
| InChI | InChI=1S/C17H12FIN4O/c18-15-6-11(13-7-21-23(19)9-13)3-4-12(15)8-22-10-16-14(17(22)24)2-1-5-20-16/h1-7,9H,8,10H2 |
| InChIKey | AIKOTVLPMPTNCV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.21 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|