C18H13FIN3O2 — CID 147222142
4-[[2-fluoro-4-(1-iodopyrazol-4-yl)phenyl]methyl]-1,4-benzoxazin-3-one (PubChem CID 147222142) has the molecular formula C18H13FIN3O2 and a molecular weight of 449.22 g/mol. Its IUPAC name is 4-[[2-fluoro-4-(1-iodopyrazol-4-yl)phenyl]methyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[[2-fluoro-4-(1-iodopyrazol-4-yl)phenyl]methyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 147222142 |
| Molecular Formula | C18H13FIN3O2 |
| Molecular Weight | 449.22 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | 4-[[2-fluoro-4-(1-iodopyrazol-4-yl)phenyl]methyl]-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccccc2N1Cc1ccc(-c2cnn(I)c2)cc1F |
| InChI | InChI=1S/C18H13FIN3O2/c19-15-7-12(14-8-21-23(20)10-14)5-6-13(15)9-22-16-3-1-2-4-17(16)25-11-18(22)24/h1-8,10H,9,11H2 |
| InChIKey | CHHCSGGFTXZNEO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|